About 2-(1H-pyrazol-4-yl)-1,3-thiazole
2-(1H-pyrazol-4-yl)-1,3-thiazole (PubChem CID 20555356) has the molecular formula C6H5N3S
and a molecular weight of 151.19 g/mol. Its IUPAC name is 2-(1H-pyrazol-4-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(1H-pyrazol-4-yl)-1,3-thiazole |
| PubChem CID | 20555356 |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | 2-(1H-pyrazol-4-yl)-1,3-thiazole |
| SMILES | c1csc(-c2cn[nH]c2)n1 |
| InChI | InChI=1S/C6H5N3S/c1-2-10-6(7-1)5-3-8-9-4-5/h1-4H,(H,8,9) |
| InChIKey | QYETZDWVJUWUTQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-pyrazol-4-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrazol-4-yl)-1,3-thiazole?
The IUPAC name of 2-(1H-pyrazol-4-yl)-1,3-thiazole (CID 20555356) is 2-(1H-pyrazol-4-yl)-1,3-thiazole.
What is the SMILES notation for 2-(1H-pyrazol-4-yl)-1,3-thiazole?
The canonical SMILES for 2-(1H-pyrazol-4-yl)-1,3-thiazole is c1csc(-c2cn[nH]c2)n1.
What is the InChIKey of 2-(1H-pyrazol-4-yl)-1,3-thiazole?
The InChIKey is QYETZDWVJUWUTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S/c1-2-10-6(7-1)5-3-8-9-4-5/h1-4H,(H,8,9).
What are the key properties of 2-(1H-pyrazol-4-yl)-1,3-thiazole?
2-(1H-pyrazol-4-yl)-1,3-thiazole has a molecular weight of 151.19 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrazol-4-yl)-1,3-thiazole is sourced from PubChem (CID 20555356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).