4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid

C8H10O3 — CID 20556121

IUPAC4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid
SMILESCC1CC2OC2C=C1C(=O)O
InChIInChI=1S/C8H10O3/c1-4-2-6-7(11-6)3-5(4)8(9)10/h3-4,6-7H,2H2,1H3,(H,9,10)
InChIKeyJJLGWVLFWTUPIS-UHFFFAOYSA-N
MW154.16 g/mol
LogP0.80
Rot. Bonds1

About 4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid

4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid (PubChem CID 20556121) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid.

Molecular Properties

Compound Name4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid
PubChem CID20556121
Molecular FormulaC8H10O3
Molecular Weight154.16 g/mol
Exact Mass154.06
IUPAC Name4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid
SMILESCC1CC2OC2C=C1C(=O)O
InChIInChI=1S/C8H10O3/c1-4-2-6-7(11-6)3-5(4)8(9)10/h3-4,6-7H,2H2,1H3,(H,9,10)
InChIKeyJJLGWVLFWTUPIS-UHFFFAOYSA-N
XLogP0.80
TPSA49.83 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.16
LogP ≤ 50.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze 4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid?
The IUPAC name of 4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid (CID 20556121) is 4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid.
What is the SMILES notation for 4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid?
The canonical SMILES for 4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid is CC1CC2OC2C=C1C(=O)O.
What is the InChIKey of 4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid?
The InChIKey is JJLGWVLFWTUPIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-4-2-6-7(11-6)3-5(4)8(9)10/h3-4,6-7H,2H2,1H3,(H,9,10).
What are the key properties of 4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid?
4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid has a molecular weight of 154.16 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid is sourced from PubChem (CID 20556121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).