C22H27Cl5N2O3 — CID 20556427
1,2,2-trichloroethyl N-[2-[4-chloro-N-(3-chloropropanoyl)anilino]cycloheptyl]-N-prop-2-enylcarbamate (PubChem CID 20556427) has the molecular formula C22H27Cl5N2O3 and a molecular weight of 544.73 g/mol. Its IUPAC name is 1,2,2-trichloroethyl N-[2-[4-chloro-N-(3-chloropropanoyl)anilino]cycloheptyl]-N-prop-2-enylcarbamate.
| Compound Name | 1,2,2-trichloroethyl N-[2-[4-chloro-N-(3-chloropropanoyl)anilino]cycloheptyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 20556427 |
| Molecular Formula | C22H27Cl5N2O3 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | 1,2,2-trichloroethyl N-[2-[4-chloro-N-(3-chloropropanoyl)anilino]cycloheptyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(Cl)C(Cl)Cl)C1CCCCCC1N(C(=O)CCCl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27Cl5N2O3/c1-2-14-28(22(31)32-21(27)20(25)26)17-6-4-3-5-7-18(17)29(19(30)12-13-23)16-10-8-15(24)9-11-16/h2,8-11,17-18,20-21H,1,3-7,12-14H2 |
| InChIKey | SNDUTHQVHAXZFV-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|