About prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate
prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate (PubChem CID 20557022) has the molecular formula C8H5F3N2O2S
and a molecular weight of 250.20 g/mol. Its IUPAC name is prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
| PubChem CID | 20557022 |
| Molecular Formula | C8H5F3N2O2S |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
| SMILES | C#CCOC(=O)c1sc(N)nc1C(F)(F)F |
| InChI | InChI=1S/C8H5F3N2O2S/c1-2-3-15-6(14)4-5(8(9,10)11)13-7(12)16-4/h1H,3H2,(H2,12,13) |
| InChIKey | ROJZBGPQUZSNGH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
The IUPAC name of prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate (CID 20557022) is prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
The canonical SMILES for prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate is C#CCOC(=O)c1sc(N)nc1C(F)(F)F.
What is the InChIKey of prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
The InChIKey is ROJZBGPQUZSNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3N2O2S/c1-2-3-15-6(14)4-5(8(9,10)11)13-7(12)16-4/h1H,3H2,(H2,12,13).
What are the key properties of prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate has a molecular weight of 250.20 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 20557022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).