C9H8Cl5NOS — CID 20557239
1-[(2,3,4,5,6-pentachlorophenyl)sulfanylamino]propan-2-ol (PubChem CID 20557239) has the molecular formula C9H8Cl5NOS and a molecular weight of 355.50 g/mol. Its IUPAC name is 1-[(2,3,4,5,6-pentachlorophenyl)sulfanylamino]propan-2-ol.
| Compound Name | 1-[(2,3,4,5,6-pentachlorophenyl)sulfanylamino]propan-2-ol |
|---|---|
| PubChem CID | 20557239 |
| Molecular Formula | C9H8Cl5NOS |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 352.88 |
| IUPAC Name | 1-[(2,3,4,5,6-pentachlorophenyl)sulfanylamino]propan-2-ol |
| SMILES | CC(O)CNSc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl5NOS/c1-3(16)2-15-17-9-7(13)5(11)4(10)6(12)8(9)14/h3,15-16H,2H2,1H3 |
| InChIKey | QWPOVLOLJUFQLF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|