C18H12Cl10N2S2 — CID 20557256
1-N,2-N-bis[(2,3,4,5,6-pentachlorophenyl)sulfanyl]cyclohexane-1,2-diamine (PubChem CID 20557256) has the molecular formula C18H12Cl10N2S2 and a molecular weight of 674.97 g/mol. Its IUPAC name is 1-N,2-N-bis[(2,3,4,5,6-pentachlorophenyl)sulfanyl]cyclohexane-1,2-diamine.
| Compound Name | 1-N,2-N-bis[(2,3,4,5,6-pentachlorophenyl)sulfanyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 20557256 |
| Molecular Formula | C18H12Cl10N2S2 |
| Molecular Weight | 674.97 g/mol |
| Exact Mass | 669.73 |
| IUPAC Name | 1-N,2-N-bis[(2,3,4,5,6-pentachlorophenyl)sulfanyl]cyclohexane-1,2-diamine |
| SMILES | Clc1c(Cl)c(Cl)c(SNC2CCCCC2NSc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C18H12Cl10N2S2/c19-7-9(21)13(25)17(14(26)10(7)22)31-29-5-3-1-2-4-6(5)30-32-18-15(27)11(23)8(20)12(24)16(18)28/h5-6,29-30H,1-4H2 |
| InChIKey | RCIMOFUDDXKULV-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.97 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|