About 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene
1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene (PubChem CID 20557377) has the molecular formula C22H19F3O2
and a molecular weight of 372.39 g/mol. Its IUPAC name is 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene.
Molecular Properties
| Compound Name | 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene |
| PubChem CID | 20557377 |
| Molecular Formula | C22H19F3O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H19F3O2/c1-26-19-12-8-17(9-13-19)21(22(23,24)25,16-6-4-3-5-7-16)18-10-14-20(27-2)15-11-18/h3-15H,1-2H3 |
| InChIKey | QIQSFYRIFRKXQW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene?
The IUPAC name of 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene (CID 20557377) is 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene.
What is the SMILES notation for 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene?
The canonical SMILES for 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene is COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)C(F)(F)F)cc1.
What is the InChIKey of 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene?
The InChIKey is QIQSFYRIFRKXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F3O2/c1-26-19-12-8-17(9-13-19)21(22(23,24)25,16-6-4-3-5-7-16)18-10-14-20(27-2)15-11-18/h3-15H,1-2H3.
What are the key properties of 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene?
1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene has a molecular weight of 372.39 g/mol, XLogP of 5.60, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-[2,2,2-trifluoro-1-(4-methoxyphenyl)-1-phenylethyl]benzene is sourced from PubChem (CID 20557377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).