About 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea
1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea (PubChem CID 20557573) has the molecular formula C10H18N4OS
and a molecular weight of 242.35 g/mol. Its IUPAC name is 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea.
Molecular Properties
| Compound Name | 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea |
| PubChem CID | 20557573 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea |
| SMILES | CNC(=S)NCCNCc1c(C)noc1C |
| InChI | InChI=1S/C10H18N4OS/c1-7-9(8(2)15-14-7)6-12-4-5-13-10(16)11-3/h12H,4-6H2,1-3H3,(H2,11,13,16) |
| InChIKey | FVZDEJHOKFUUBC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea?
The IUPAC name of 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea (CID 20557573) is 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea.
What is the SMILES notation for 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea?
The canonical SMILES for 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea is CNC(=S)NCCNCc1c(C)noc1C.
What is the InChIKey of 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea?
The InChIKey is FVZDEJHOKFUUBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4OS/c1-7-9(8(2)15-14-7)6-12-4-5-13-10(16)11-3/h12H,4-6H2,1-3H3,(H2,11,13,16).
What are the key properties of 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea?
1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea has a molecular weight of 242.35 g/mol, XLogP of 0.47, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]-3-methylthiourea is sourced from PubChem (CID 20557573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).