About 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea
1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea (PubChem CID 20557666) has the molecular formula C9H16N4S2
and a molecular weight of 244.39 g/mol. Its IUPAC name is 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea.
Molecular Properties
| Compound Name | 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea |
| PubChem CID | 20557666 |
| Molecular Formula | C9H16N4S2 |
| Molecular Weight | 244.39 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea |
| SMILES | CNC(=S)NCCNCCc1ccsn1 |
| InChI | InChI=1S/C9H16N4S2/c1-10-9(14)12-6-5-11-4-2-8-3-7-15-13-8/h3,7,11H,2,4-6H2,1H3,(H2,10,12,14) |
| InChIKey | BIRYYZLKURXWCG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea?
The IUPAC name of 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea (CID 20557666) is 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea.
What is the SMILES notation for 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea?
The canonical SMILES for 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea is CNC(=S)NCCNCCc1ccsn1.
What is the InChIKey of 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea?
The InChIKey is BIRYYZLKURXWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4S2/c1-10-9(14)12-6-5-11-4-2-8-3-7-15-13-8/h3,7,11H,2,4-6H2,1H3,(H2,10,12,14).
What are the key properties of 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea?
1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea has a molecular weight of 244.39 g/mol, XLogP of 0.37, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[2-[2-(1,2-thiazol-3-yl)ethylamino]ethyl]thiourea is sourced from PubChem (CID 20557666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).