About 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide
5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide (PubChem CID 20557861) has the molecular formula C5H12Br2N4S2
and a molecular weight of 352.12 g/mol. Its IUPAC name is 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide.
Molecular Properties
| Compound Name | 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide |
| PubChem CID | 20557861 |
| Molecular Formula | C5H12Br2N4S2 |
| Molecular Weight | 352.12 g/mol |
| Exact Mass | 349.89 |
| IUPAC Name | 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide |
| SMILES | Br.Br.NCCCSc1nnc(N)s1 |
| InChI | InChI=1S/C5H10N4S2.2BrH/c6-2-1-3-10-5-9-8-4(7)11-5;;/h1-3,6H2,(H2,7,8);2*1H |
| InChIKey | YBGBLUZGGUPDLC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.12 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide?
The IUPAC name of 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide (CID 20557861) is 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide.
What is the SMILES notation for 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide?
The canonical SMILES for 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide is Br.Br.NCCCSc1nnc(N)s1.
What is the InChIKey of 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide?
The InChIKey is YBGBLUZGGUPDLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4S2.2BrH/c6-2-1-3-10-5-9-8-4(7)11-5;;/h1-3,6H2,(H2,7,8);2*1H.
What are the key properties of 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide?
5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide has a molecular weight of 352.12 g/mol, XLogP of 1.72, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-aminopropylsulfanyl)-1,3,4-thiadiazol-2-amine;dihydrobromide is sourced from PubChem (CID 20557861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).