C12H18O3 — CID 20558078
(1-oxo-3,3a,4,5,6,7,8,8a-octahydro-2H-azulen-5-yl) acetate (PubChem CID 20558078) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1-oxo-3,3a,4,5,6,7,8,8a-octahydro-2H-azulen-5-yl) acetate.
| Compound Name | (1-oxo-3,3a,4,5,6,7,8,8a-octahydro-2H-azulen-5-yl) acetate |
|---|---|
| PubChem CID | 20558078 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1-oxo-3,3a,4,5,6,7,8,8a-octahydro-2H-azulen-5-yl) acetate |
| SMILES | CC(=O)OC1CCCC2C(=O)CCC2C1 |
| InChI | InChI=1S/C12H18O3/c1-8(13)15-10-3-2-4-11-9(7-10)5-6-12(11)14/h9-11H,2-7H2,1H3 |
| InChIKey | VAPIJWXAFODKCJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |