C11H14NO4S2- — CID 2055816
(3R)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate (PubChem CID 2055816) has the molecular formula C11H14NO4S2- and a molecular weight of 288.37 g/mol. Its IUPAC name is (3R)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (3R)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 2055816 |
| Molecular Formula | C11H14NO4S2- |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | (3R)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@@H](C(=O)[O-])C2)s1 |
| InChI | InChI=1S/C11H15NO4S2/c1-8-4-5-10(17-8)18(15,16)12-6-2-3-9(7-12)11(13)14/h4-5,9H,2-3,6-7H2,1H3,(H,13,14)/p-1/t9-/m1/s1 |
| InChIKey | QKLAHLXSXCSXCN-SECBINFHSA-M |
| XLogP | 0.21 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |