C21H27N3O2S — CID 20558685
1-(3-ethylpent-1-ynylamino)-3-[2-[(E)-2-(5-methyl-1,3,4-thiadiazol-2-yl)ethenyl]phenoxy]propan-2-ol (PubChem CID 20558685) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-(3-ethylpent-1-ynylamino)-3-[2-[(E)-2-(5-methyl-1,3,4-thiadiazol-2-yl)ethenyl]phenoxy]propan-2-ol.
| Compound Name | 1-(3-ethylpent-1-ynylamino)-3-[2-[(E)-2-(5-methyl-1,3,4-thiadiazol-2-yl)ethenyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 20558685 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-(3-ethylpent-1-ynylamino)-3-[2-[(E)-2-(5-methyl-1,3,4-thiadiazol-2-yl)ethenyl]phenoxy]propan-2-ol |
| SMILES | CCC(C#CNCC(O)COc1ccccc1/C=C/c1nnc(C)s1)CC |
| InChI | InChI=1S/C21H27N3O2S/c1-4-17(5-2)12-13-22-14-19(25)15-26-20-9-7-6-8-18(20)10-11-21-24-23-16(3)27-21/h6-11,17,19,22,25H,4-5,14-15H2,1-3H3/b11-10+ |
| InChIKey | KCOMTOHZIGUXRC-ZHACJKMWSA-N |
| XLogP | 3.74 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|