About (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole
(2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole (PubChem CID 2055901) has the molecular formula C18H18N2O2S
and a molecular weight of 326.42 g/mol. Its IUPAC name is (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole.
Molecular Properties
| Compound Name | (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole |
| PubChem CID | 2055901 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole |
| SMILES | CN1/C(=C\Sc2ccccc2[N+](=O)[O-])C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C18H18N2O2S/c1-18(2)13-8-4-5-9-14(13)19(3)17(18)12-23-16-11-7-6-10-15(16)20(21)22/h4-12H,1-3H3/b17-12- |
| InChIKey | NDDATGWDZBPVCW-ATVHPVEESA-N |
| XLogP | 4.96 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole?
The IUPAC name of (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole (CID 2055901) is (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole.
What is the SMILES notation for (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole?
The canonical SMILES for (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole is CN1/C(=C\Sc2ccccc2[N+](=O)[O-])C(C)(C)c2ccccc21.
What is the InChIKey of (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole?
The InChIKey is NDDATGWDZBPVCW-ATVHPVEESA-N. The full InChI is InChI=1S/C18H18N2O2S/c1-18(2)13-8-4-5-9-14(13)19(3)17(18)12-23-16-11-7-6-10-15(16)20(21)22/h4-12H,1-3H3/b17-12-.
What are the key properties of (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole?
(2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole has a molecular weight of 326.42 g/mol, XLogP of 4.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-1,3,3-trimethyl-2-[(2-nitrophenyl)sulfanylmethylidene]indole is sourced from PubChem (CID 2055901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).