About [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane
[2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane (PubChem CID 20559358) has the molecular formula C12H8BrCl2O2PS
and a molecular weight of 398.05 g/mol. Its IUPAC name is [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane |
| PubChem CID | 20559358 |
| Molecular Formula | C12H8BrCl2O2PS |
| Molecular Weight | 398.05 g/mol |
| Exact Mass | 395.85 |
| IUPAC Name | [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane |
| SMILES | OP(O)(=S)c1ccccc1-c1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C12H8BrCl2O2PS/c13-9-6-10(14)8(5-11(9)15)7-3-1-2-4-12(7)18(16,17)19/h1-6H,(H2,16,17,19) |
| InChIKey | RKNGUOVZTPODPV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.05 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane?
The IUPAC name of [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane (CID 20559358) is [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane.
What is the SMILES notation for [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane?
The canonical SMILES for [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane is OP(O)(=S)c1ccccc1-c1cc(Cl)c(Br)cc1Cl.
What is the InChIKey of [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane?
The InChIKey is RKNGUOVZTPODPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrCl2O2PS/c13-9-6-10(14)8(5-11(9)15)7-3-1-2-4-12(7)18(16,17)19/h1-6H,(H2,16,17,19).
What are the key properties of [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane?
[2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane has a molecular weight of 398.05 g/mol, XLogP of 4.34, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromo-2,5-dichlorophenyl)phenyl]-dihydroxy-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 20559358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).