C32H50O4 — CID 20559476
(11-methoxy-11-oxoundecyl) (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 20559476) has the molecular formula C32H50O4 and a molecular weight of 498.75 g/mol. Its IUPAC name is (11-methoxy-11-oxoundecyl) (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | (11-methoxy-11-oxoundecyl) (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 20559476 |
| Molecular Formula | C32H50O4 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | (11-methoxy-11-oxoundecyl) (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | COC(=O)CCCCCCCCCCOC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C32H50O4/c1-26(21-22-29-28(3)19-16-23-32(29,4)5)17-15-18-27(2)25-31(34)36-24-14-12-10-8-7-9-11-13-20-30(33)35-6/h15,17-18,21-22,25H,7-14,16,19-20,23-24H2,1-6H3/b18-15+,22-21+,26-17+,27-25+ |
| InChIKey | JEPOEGSRWXXYQG-CEPYWHBRSA-N |
| XLogP | 8.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|