2,2-bis(10-sulfanyldecyl)hexanedioic acid

C26H50O4S2 — CID 20559919

IUPAC2,2-bis(10-sulfanyldecyl)hexanedioic acid
SMILESO=C(O)CCCC(CCCCCCCCCCS)(CCCCCCCCCCS)C(=O)O
InChIInChI=1S/C26H50O4S2/c27-24(28)18-17-21-26(25(29)30,19-13-9-5-1-3-7-11-15-22-31)20-14-10-6-2-4-8-12-16-23-32/h31-32H,1-23H2,(H,27,28)(H,29,30)
InChIKeyNDEJBUJWLPOBFI-UHFFFAOYSA-N
MW490.82 g/mol
LogP8.19
Rot. Bonds25

About 2,2-bis(10-sulfanyldecyl)hexanedioic acid

2,2-bis(10-sulfanyldecyl)hexanedioic acid (PubChem CID 20559919) has the molecular formula C26H50O4S2 and a molecular weight of 490.82 g/mol. Its IUPAC name is 2,2-bis(10-sulfanyldecyl)hexanedioic acid.

Molecular Properties

Compound Name2,2-bis(10-sulfanyldecyl)hexanedioic acid
PubChem CID20559919
Molecular FormulaC26H50O4S2
Molecular Weight490.82 g/mol
Exact Mass490.32
IUPAC Name2,2-bis(10-sulfanyldecyl)hexanedioic acid
SMILESO=C(O)CCCC(CCCCCCCCCCS)(CCCCCCCCCCS)C(=O)O
InChIInChI=1S/C26H50O4S2/c27-24(28)18-17-21-26(25(29)30,19-13-9-5-1-3-7-11-15-22-31)20-14-10-6-2-4-8-12-16-23-32/h31-32H,1-23H2,(H,27,28)(H,29,30)
InChIKeyNDEJBUJWLPOBFI-UHFFFAOYSA-N
XLogP8.19
TPSA74.60 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds25
Heavy Atoms32
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500490.82
LogP ≤ 58.19
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2,2-bis(10-sulfanyldecyl)hexanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,2-bis(4-sulfanylbutyl)hexanedioic acid
CID 20559940
33-sulfanyltritriacontanoic acid
CID 87682826
2,2-bis(2-hydroxyethyl)tridecanedioic acid
CID 87535723
2,2-dipentylhexanedioic acid
CID 87342784
2,2-bis(3-aminopropyl)hexanedioic acid
CID 88846821
2,2-di(docosyl)nonanedioic acid
CID 88541334
2,2-dioctylnonanedioic acid
CID 19037211
2,2-di(tridecyl)dodecanedioic acid
CID 88920824
2,2-didecylheptanedioic acid
CID 123371306
2,2-bis(10-methylundecyl)hexanedioic acid
CID 88541306
2,2-bis(6-methylheptyl)hexanedioic acid
CID 18785345
CID 126646561
CID 126646561

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(10-sulfanyldecyl)hexanedioic acid?
The IUPAC name of 2,2-bis(10-sulfanyldecyl)hexanedioic acid (CID 20559919) is 2,2-bis(10-sulfanyldecyl)hexanedioic acid.
What is the SMILES notation for 2,2-bis(10-sulfanyldecyl)hexanedioic acid?
The canonical SMILES for 2,2-bis(10-sulfanyldecyl)hexanedioic acid is O=C(O)CCCC(CCCCCCCCCCS)(CCCCCCCCCCS)C(=O)O.
What is the InChIKey of 2,2-bis(10-sulfanyldecyl)hexanedioic acid?
The InChIKey is NDEJBUJWLPOBFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H50O4S2/c27-24(28)18-17-21-26(25(29)30,19-13-9-5-1-3-7-11-15-22-31)20-14-10-6-2-4-8-12-16-23-32/h31-32H,1-23H2,(H,27,28)(H,29,30).
What are the key properties of 2,2-bis(10-sulfanyldecyl)hexanedioic acid?
2,2-bis(10-sulfanyldecyl)hexanedioic acid has a molecular weight of 490.82 g/mol, XLogP of 8.19, 25 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(10-sulfanyldecyl)hexanedioic acid is sourced from PubChem (CID 20559919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).