About N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide
N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide (PubChem CID 20560227) has the molecular formula C18H22BrNO
and a molecular weight of 348.28 g/mol. Its IUPAC name is N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide.
Molecular Properties
| Compound Name | N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide |
| PubChem CID | 20560227 |
| Molecular Formula | C18H22BrNO |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide |
| SMILES | Br.CN(C)CC1CC(c2ccccc2)c2ccccc2O1 |
| InChI | InChI=1S/C18H21NO.BrH/c1-19(2)13-15-12-17(14-8-4-3-5-9-14)16-10-6-7-11-18(16)20-15;/h3-11,15,17H,12-13H2,1-2H3;1H |
| InChIKey | VGMGTBAYYCZZNH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide?
The IUPAC name of N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide (CID 20560227) is N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide.
What is the SMILES notation for N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide?
The canonical SMILES for N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide is Br.CN(C)CC1CC(c2ccccc2)c2ccccc2O1.
What is the InChIKey of N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide?
The InChIKey is VGMGTBAYYCZZNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO.BrH/c1-19(2)13-15-12-17(14-8-4-3-5-9-14)16-10-6-7-11-18(16)20-15;/h3-11,15,17H,12-13H2,1-2H3;1H.
What are the key properties of N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide?
N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide has a molecular weight of 348.28 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(4-phenyl-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrobromide is sourced from PubChem (CID 20560227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).