C10H9BrF3N3O3 — CID 20560561
4-bromo-5-hydroxy-1-prop-2-enyl-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]imidazolidin-2-one (PubChem CID 20560561) has the molecular formula C10H9BrF3N3O3 and a molecular weight of 356.10 g/mol. Its IUPAC name is 4-bromo-5-hydroxy-1-prop-2-enyl-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]imidazolidin-2-one.
| Compound Name | 4-bromo-5-hydroxy-1-prop-2-enyl-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]imidazolidin-2-one |
|---|---|
| PubChem CID | 20560561 |
| Molecular Formula | C10H9BrF3N3O3 |
| Molecular Weight | 356.10 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 4-bromo-5-hydroxy-1-prop-2-enyl-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]imidazolidin-2-one |
| SMILES | C=CCN1C(=O)N(c2cc(C(F)(F)F)no2)C(Br)C1O |
| InChI | InChI=1S/C10H9BrF3N3O3/c1-2-3-16-8(18)7(11)17(9(16)19)6-4-5(15-20-6)10(12,13)14/h2,4,7-8,18H,1,3H2 |
| InChIKey | NOJJCEQUYIDORF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.10 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|