C21H25N3O3 — CID 20560568
5-hydroxy-1-[5-(2-phenylpropan-2-yl)-1,2-oxazol-3-yl]-3,4-bis(prop-2-enyl)imidazolidin-2-one (PubChem CID 20560568) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-hydroxy-1-[5-(2-phenylpropan-2-yl)-1,2-oxazol-3-yl]-3,4-bis(prop-2-enyl)imidazolidin-2-one.
| Compound Name | 5-hydroxy-1-[5-(2-phenylpropan-2-yl)-1,2-oxazol-3-yl]-3,4-bis(prop-2-enyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 20560568 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 5-hydroxy-1-[5-(2-phenylpropan-2-yl)-1,2-oxazol-3-yl]-3,4-bis(prop-2-enyl)imidazolidin-2-one |
| SMILES | C=CCC1C(O)N(c2cc(C(C)(C)c3ccccc3)on2)C(=O)N1CC=C |
| InChI | InChI=1S/C21H25N3O3/c1-5-10-16-19(25)24(20(26)23(16)13-6-2)18-14-17(27-22-18)21(3,4)15-11-8-7-9-12-15/h5-9,11-12,14,16,19,25H,1-2,10,13H2,3-4H3 |
| InChIKey | GETQVCFNXHMGHO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|