About 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one
3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one (PubChem CID 20560633) has the molecular formula C13H19N3O3
and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one.
Molecular Properties
| Compound Name | 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one |
| PubChem CID | 20560633 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one |
| SMILES | C=CCN1CC(O)N(c2cc(C(C)(C)C)no2)C1=O |
| InChI | InChI=1S/C13H19N3O3/c1-5-6-15-8-10(17)16(12(15)18)11-7-9(14-19-11)13(2,3)4/h5,7,10,17H,1,6,8H2,2-4H3 |
| InChIKey | HJCVQZXNISKJGR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one?
The IUPAC name of 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one (CID 20560633) is 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one.
What is the SMILES notation for 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one?
The canonical SMILES for 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one is C=CCN1CC(O)N(c2cc(C(C)(C)C)no2)C1=O.
What is the InChIKey of 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one?
The InChIKey is HJCVQZXNISKJGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O3/c1-5-6-15-8-10(17)16(12(15)18)11-7-9(14-19-11)13(2,3)4/h5,7,10,17H,1,6,8H2,2-4H3.
What are the key properties of 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one?
3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one has a molecular weight of 265.31 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-tert-butyl-1,2-oxazol-5-yl)-4-hydroxy-1-prop-2-enylimidazolidin-2-one is sourced from PubChem (CID 20560633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).