C13H18ClN3O4 — CID 20560717
1-[5-(1-chloro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]-4,5-dihydroxy-3-prop-2-enylimidazolidin-2-one (PubChem CID 20560717) has the molecular formula C13H18ClN3O4 and a molecular weight of 315.76 g/mol. Its IUPAC name is 1-[5-(1-chloro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]-4,5-dihydroxy-3-prop-2-enylimidazolidin-2-one.
| Compound Name | 1-[5-(1-chloro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]-4,5-dihydroxy-3-prop-2-enylimidazolidin-2-one |
|---|---|
| PubChem CID | 20560717 |
| Molecular Formula | C13H18ClN3O4 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-[5-(1-chloro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]-4,5-dihydroxy-3-prop-2-enylimidazolidin-2-one |
| SMILES | C=CCN1C(=O)N(c2cc(C(C)(C)CCl)on2)C(O)C1O |
| InChI | InChI=1S/C13H18ClN3O4/c1-4-5-16-10(18)11(19)17(12(16)20)9-6-8(21-15-9)13(2,3)7-14/h4,6,10-11,18-19H,1,5,7H2,2-3H3 |
| InChIKey | RHMMQEGGWGRTFP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|