C14H9ClN2O5 — CID 20561041
8-chloro-2-(methoxyamino)-10-oxochromeno[3,2-b]pyridine-3-carboxylic acid (PubChem CID 20561041) has the molecular formula C14H9ClN2O5 and a molecular weight of 320.69 g/mol. Its IUPAC name is 8-chloro-2-(methoxyamino)-10-oxochromeno[3,2-b]pyridine-3-carboxylic acid.
| Compound Name | 8-chloro-2-(methoxyamino)-10-oxochromeno[3,2-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 20561041 |
| Molecular Formula | C14H9ClN2O5 |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 8-chloro-2-(methoxyamino)-10-oxochromeno[3,2-b]pyridine-3-carboxylic acid |
| SMILES | CONc1nc2c(=O)c3cc(Cl)ccc3oc2cc1C(=O)O |
| InChI | InChI=1S/C14H9ClN2O5/c1-21-17-13-8(14(19)20)5-10-11(16-13)12(18)7-4-6(15)2-3-9(7)22-10/h2-5H,1H3,(H,16,17)(H,19,20) |
| InChIKey | CHXKFYYLVQJIFE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|