C29H31F3N2O4 — CID 20561390
diethyl 1-(N-ethyl-C-phenylcarbonimidoyl)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate (PubChem CID 20561390) has the molecular formula C29H31F3N2O4 and a molecular weight of 528.57 g/mol. Its IUPAC name is diethyl 1-(N-ethyl-C-phenylcarbonimidoyl)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1-(N-ethyl-C-phenylcarbonimidoyl)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 20561390 |
| Molecular Formula | C29H31F3N2O4 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | diethyl 1-(N-ethyl-C-phenylcarbonimidoyl)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate |
| SMILES | CC/N=C(\c1ccccc1)N1C(C)=C(C(=O)OCC)C(c2ccccc2C(F)(F)F)C(C(=O)OCC)=C1C |
| InChI | InChI=1S/C29H31F3N2O4/c1-6-33-26(20-14-10-9-11-15-20)34-18(4)23(27(35)37-7-2)25(24(19(34)5)28(36)38-8-3)21-16-12-13-17-22(21)29(30,31)32/h9-17,25H,6-8H2,1-5H3/b33-26+ |
| InChIKey | ALENIAFMFANHTD-MHTZHOPKSA-N |
| XLogP | 6.25 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|