C30H33F3N2O4 — CID 20561394
diethyl 2,6-dimethyl-1-(C-phenyl-N-propylcarbonimidoyl)-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate (PubChem CID 20561394) has the molecular formula C30H33F3N2O4 and a molecular weight of 542.60 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-1-(C-phenyl-N-propylcarbonimidoyl)-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-dimethyl-1-(C-phenyl-N-propylcarbonimidoyl)-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 20561394 |
| Molecular Formula | C30H33F3N2O4 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | diethyl 2,6-dimethyl-1-(C-phenyl-N-propylcarbonimidoyl)-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCC/N=C(\c1ccccc1)N1C(C)=C(C(=O)OCC)C(c2ccccc2C(F)(F)F)C(C(=O)OCC)=C1C |
| InChI | InChI=1S/C30H33F3N2O4/c1-6-18-34-27(21-14-10-9-11-15-21)35-19(4)24(28(36)38-7-2)26(25(20(35)5)29(37)39-8-3)22-16-12-13-17-23(22)30(31,32)33/h9-17,26H,6-8,18H2,1-5H3/b34-27+ |
| InChIKey | XHUCDNBRSXKJRP-DNGXXSEMSA-N |
| XLogP | 6.64 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|