About 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium
1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium (PubChem CID 20561635) has the molecular formula C14H30N+
and a molecular weight of 212.40 g/mol. Its IUPAC name is 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium.
Molecular Properties
| Compound Name | 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium |
| PubChem CID | 20561635 |
| Molecular Formula | C14H30N+ |
| Molecular Weight | 212.40 g/mol |
| Exact Mass | 212.24 |
| IUPAC Name | 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium |
| SMILES | CCCC1(C)CCCC[N+]1(CC)CCC |
| InChI | InChI=1S/C14H30N/c1-5-10-14(4)11-8-9-13-15(14,7-3)12-6-2/h5-13H2,1-4H3/q+1 |
| InChIKey | UWFVJAKYTVEMOZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium?
The IUPAC name of 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium (CID 20561635) is 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium.
What is the SMILES notation for 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium?
The canonical SMILES for 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium is CCCC1(C)CCCC[N+]1(CC)CCC.
What is the InChIKey of 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium?
The InChIKey is UWFVJAKYTVEMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N/c1-5-10-14(4)11-8-9-13-15(14,7-3)12-6-2/h5-13H2,1-4H3/q+1.
What are the key properties of 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium?
1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium has a molecular weight of 212.40 g/mol, XLogP of 3.98, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-methyl-1,2-dipropylpiperidin-1-ium is sourced from PubChem (CID 20561635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).