About magnesium;cyclodecane;bromide
magnesium;cyclodecane;bromide (PubChem CID 20561684) has the molecular formula C10H19BrMg
and a molecular weight of 243.47 g/mol. Its IUPAC name is magnesium;cyclodecane;bromide.
Molecular Properties
| Compound Name | magnesium;cyclodecane;bromide |
|---|
| PubChem CID | 20561684 |
|---|
| Molecular Formula | C10H19BrMg |
|---|
| Molecular Weight | 243.47 g/mol |
|---|
| Exact Mass | 242.05 |
|---|
| IUPAC Name | magnesium;cyclodecane;bromide |
|---|
| SMILES | [Br-].[CH-]1CCCCCCCCC1.[Mg+2] |
|---|
| InChI | InChI=1S/C10H19.BrH.Mg/c1-2-4-6-8-10-9-7-5-3-1;;/h1H,2-10H2;1H;/q-1;;+2/p-1 |
|---|
| InChIKey | MVRCIDLEUGOKHE-UHFFFAOYSA-M |
|---|
| XLogP | 0.34 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 12 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 243.47 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;cyclodecane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;cyclodecane;bromide?
The IUPAC name of magnesium;cyclodecane;bromide (CID 20561684) is magnesium;cyclodecane;bromide.
What is the SMILES notation for magnesium;cyclodecane;bromide?
The canonical SMILES for magnesium;cyclodecane;bromide is [Br-].[CH-]1CCCCCCCCC1.[Mg+2].
What is the InChIKey of magnesium;cyclodecane;bromide?
The InChIKey is MVRCIDLEUGOKHE-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H19.BrH.Mg/c1-2-4-6-8-10-9-7-5-3-1;;/h1H,2-10H2;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;cyclodecane;bromide?
magnesium;cyclodecane;bromide has a molecular weight of 243.47 g/mol, XLogP of 0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;cyclodecane;bromide is sourced from PubChem (CID 20561684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).