About N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride
N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride (PubChem CID 20562140) has the molecular formula C20H22ClNO2
and a molecular weight of 343.85 g/mol. Its IUPAC name is N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride.
Molecular Properties
| Compound Name | N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride |
| PubChem CID | 20562140 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride |
| SMILES | CON=C1CCC2(CC1)OC(c1ccccc1)c1ccccc12.Cl |
| InChI | InChI=1S/C20H21NO2.ClH/c1-22-21-16-11-13-20(14-12-16)18-10-6-5-9-17(18)19(23-20)15-7-3-2-4-8-15;/h2-10,19H,11-14H2,1H3;1H/b21-16-; |
| InChIKey | MLMBLSKECTZLEL-PLMZOXRSSA-N |
| XLogP | 5.00 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride?
The IUPAC name of N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride (CID 20562140) is N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride.
What is the SMILES notation for N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride?
The canonical SMILES for N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride is CON=C1CCC2(CC1)OC(c1ccccc1)c1ccccc12.Cl.
What is the InChIKey of N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride?
The InChIKey is MLMBLSKECTZLEL-PLMZOXRSSA-N. The full InChI is InChI=1S/C20H21NO2.ClH/c1-22-21-16-11-13-20(14-12-16)18-10-6-5-9-17(18)19(23-20)15-7-3-2-4-8-15;/h2-10,19H,11-14H2,1H3;1H/b21-16-;.
What are the key properties of N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride?
N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride has a molecular weight of 343.85 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-1-phenylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-imine;hydrochloride is sourced from PubChem (CID 20562140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).