About 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate
3-(2,6-dichlorophenyl)propyl dihydrogen phosphate (PubChem CID 20562192) has the molecular formula C9H11Cl2O4P
and a molecular weight of 285.06 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate.
Molecular Properties
| Compound Name | 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate |
| PubChem CID | 20562192 |
| Molecular Formula | C9H11Cl2O4P |
| Molecular Weight | 285.06 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCCCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H11Cl2O4P/c10-8-4-1-5-9(11)7(8)3-2-6-15-16(12,13)14/h1,4-5H,2-3,6H2,(H2,12,13,14) |
| InChIKey | POTSJWGFPSRAHJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.06 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate?
The IUPAC name of 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate (CID 20562192) is 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate.
What is the SMILES notation for 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate?
The canonical SMILES for 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate is O=P(O)(O)OCCCc1c(Cl)cccc1Cl.
What is the InChIKey of 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate?
The InChIKey is POTSJWGFPSRAHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl2O4P/c10-8-4-1-5-9(11)7(8)3-2-6-15-16(12,13)14/h1,4-5H,2-3,6H2,(H2,12,13,14).
What are the key properties of 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate?
3-(2,6-dichlorophenyl)propyl dihydrogen phosphate has a molecular weight of 285.06 g/mol, XLogP of 3.04, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dichlorophenyl)propyl dihydrogen phosphate is sourced from PubChem (CID 20562192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).