About ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate
ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate (PubChem CID 20563114) has the molecular formula C22H39NO5
and a molecular weight of 397.56 g/mol. Its IUPAC name is ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate.
Molecular Properties
| Compound Name | ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate |
| PubChem CID | 20563114 |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate |
| SMILES | CCCCCC(O)CCN1C(=O)CCC(=O)C1CCCCCCC(=O)OCC |
| InChI | InChI=1S/C22H39NO5/c1-3-5-8-11-18(24)16-17-23-19(20(25)14-15-21(23)26)12-9-6-7-10-13-22(27)28-4-2/h18-19,24H,3-17H2,1-2H3 |
| InChIKey | VJXQWJWTEKZCMV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate?
The IUPAC name of ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate (CID 20563114) is ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate.
What is the SMILES notation for ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate?
The canonical SMILES for ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate is CCCCCC(O)CCN1C(=O)CCC(=O)C1CCCCCCC(=O)OCC.
What is the InChIKey of ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate?
The InChIKey is VJXQWJWTEKZCMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H39NO5/c1-3-5-8-11-18(24)16-17-23-19(20(25)14-15-21(23)26)12-9-6-7-10-13-22(27)28-4-2/h18-19,24H,3-17H2,1-2H3.
What are the key properties of ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate?
ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate has a molecular weight of 397.56 g/mol, XLogP of 3.78, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[1-(3-hydroxyoctyl)-3,6-dioxopiperidin-2-yl]heptanoate is sourced from PubChem (CID 20563114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).