C23H36N4O — CID 20563442
4-(ethylamino)-1-(2,4,6-tributylphenyl)-1,3,5-triazin-2-one (PubChem CID 20563442) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is 4-(ethylamino)-1-(2,4,6-tributylphenyl)-1,3,5-triazin-2-one.
| Compound Name | 4-(ethylamino)-1-(2,4,6-tributylphenyl)-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 20563442 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 4-(ethylamino)-1-(2,4,6-tributylphenyl)-1,3,5-triazin-2-one |
| SMILES | CCCCc1cc(CCCC)c(-n2cnc(NCC)nc2=O)c(CCCC)c1 |
| InChI | InChI=1S/C23H36N4O/c1-5-9-12-18-15-19(13-10-6-2)21(20(16-18)14-11-7-3)27-17-25-22(24-8-4)26-23(27)28/h15-17H,5-14H2,1-4H3,(H,24,26,28) |
| InChIKey | BLEIDYMRHOOVSP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |