C22H30N2O3 — CID 20563543
N-cycloheptyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-prop-2-enylpropanamide (PubChem CID 20563543) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is N-cycloheptyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-prop-2-enylpropanamide.
| Compound Name | N-cycloheptyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 20563543 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | N-cycloheptyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C(=O)CCOc1ccc2c(c1)CCC(=O)N2)C1CCCCCC1 |
| InChI | InChI=1S/C22H30N2O3/c1-2-14-24(18-7-5-3-4-6-8-18)22(26)13-15-27-19-10-11-20-17(16-19)9-12-21(25)23-20/h2,10-11,16,18H,1,3-9,12-15H2,(H,23,25) |
| InChIKey | OFOMVZACHPYATP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|