About N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide
N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide (PubChem CID 20563594) has the molecular formula C22H30N2O3
and a molecular weight of 370.49 g/mol. Its IUPAC name is N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide |
| PubChem CID | 20563594 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide |
| SMILES | CC(COc1ccc2ccc(=O)n(C)c2c1)CC(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C22H30N2O3/c1-16(13-22(26)23(2)18-7-5-4-6-8-18)15-27-19-11-9-17-10-12-21(25)24(3)20(17)14-19/h9-12,14,16,18H,4-8,13,15H2,1-3H3 |
| InChIKey | ZWBGOHLLYWXPJE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide?
The IUPAC name of N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide (CID 20563594) is N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide.
What is the SMILES notation for N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide?
The canonical SMILES for N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide is CC(COc1ccc2ccc(=O)n(C)c2c1)CC(=O)N(C)C1CCCCC1.
What is the InChIKey of N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide?
The InChIKey is ZWBGOHLLYWXPJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2O3/c1-16(13-22(26)23(2)18-7-5-4-6-8-18)15-27-19-11-9-17-10-12-21(25)24(3)20(17)14-19/h9-12,14,16,18H,4-8,13,15H2,1-3H3.
What are the key properties of N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide?
N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide has a molecular weight of 370.49 g/mol, XLogP of 3.73, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N,3-dimethyl-4-(1-methyl-2-oxoquinolin-7-yl)oxybutanamide is sourced from PubChem (CID 20563594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).