C20H27NO4 — CID 20563695
diethyl (E)-2-(benzylideneamino)non-4-enedioate (PubChem CID 20563695) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is diethyl (E)-2-(benzylideneamino)non-4-enedioate.
| Compound Name | diethyl (E)-2-(benzylideneamino)non-4-enedioate |
|---|---|
| PubChem CID | 20563695 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | diethyl (E)-2-(benzylideneamino)non-4-enedioate |
| SMILES | CCOC(=O)CCC/C=C/CC(/N=C/c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C20H27NO4/c1-3-24-19(22)15-11-6-5-10-14-18(20(23)25-4-2)21-16-17-12-8-7-9-13-17/h5,7-10,12-13,16,18H,3-4,6,11,14-15H2,1-2H3/b10-5+,21-16+ |
| InChIKey | BGNCNGKFYCYWEF-BXRAMVFESA-N |
| XLogP | 3.72 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|