C13H12N2O2S — CID 20564192
7,8-dimethyl-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidin-4-one (PubChem CID 20564192) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 7,8-dimethyl-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidin-4-one.
| Compound Name | 7,8-dimethyl-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 20564192 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 7,8-dimethyl-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc2c(cc1C)Oc1[nH]c(=S)[nH]c(=O)c1C2 |
| InChI | InChI=1S/C13H12N2O2S/c1-6-3-8-5-9-11(16)14-13(18)15-12(9)17-10(8)4-7(6)2/h3-4H,5H2,1-2H3,(H2,14,15,16,18) |
| InChIKey | RDOMMALIAIVKSG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|