About 2-chloropyran-4-one
2-chloropyran-4-one (PubChem CID 20564400) has the molecular formula C5H3ClO2
and a molecular weight of 130.53 g/mol. Its IUPAC name is 2-chloropyran-4-one.
Molecular Properties
| Compound Name | 2-chloropyran-4-one |
| PubChem CID | 20564400 |
| Molecular Formula | C5H3ClO2 |
| Molecular Weight | 130.53 g/mol |
| Exact Mass | 129.98 |
| IUPAC Name | 2-chloropyran-4-one |
| SMILES | O=c1ccoc(Cl)c1 |
| InChI | InChI=1S/C5H3ClO2/c6-5-3-4(7)1-2-8-5/h1-3H |
| InChIKey | KKEPUPJXSBSRAC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.53 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropyran-4-one?
The IUPAC name of 2-chloropyran-4-one (CID 20564400) is 2-chloropyran-4-one.
What is the SMILES notation for 2-chloropyran-4-one?
The canonical SMILES for 2-chloropyran-4-one is O=c1ccoc(Cl)c1.
What is the InChIKey of 2-chloropyran-4-one?
The InChIKey is KKEPUPJXSBSRAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClO2/c6-5-3-4(7)1-2-8-5/h1-3H.
What are the key properties of 2-chloropyran-4-one?
2-chloropyran-4-one has a molecular weight of 130.53 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyran-4-one is sourced from PubChem (CID 20564400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).