About 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide
2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide (PubChem CID 20564690) has the molecular formula C10H16BrCl5N2O2
and a molecular weight of 453.42 g/mol. Its IUPAC name is 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide.
Molecular Properties
| Compound Name | 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide |
| PubChem CID | 20564690 |
| Molecular Formula | C10H16BrCl5N2O2 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 449.88 |
| IUPAC Name | 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide |
| SMILES | NC(=O)C(CCl)(CCl)CBr.NC(=O)C(CCl)(CCl)CCl |
| InChI | InChI=1S/C5H8BrCl2NO.C5H8Cl3NO/c2*6-1-5(2-7,3-8)4(9)10/h2*1-3H2,(H2,9,10) |
| InChIKey | IHSFMSBZYLPEIE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide?
The IUPAC name of 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide (CID 20564690) is 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide.
What is the SMILES notation for 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide?
The canonical SMILES for 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide is NC(=O)C(CCl)(CCl)CBr.NC(=O)C(CCl)(CCl)CCl.
What is the InChIKey of 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide?
The InChIKey is IHSFMSBZYLPEIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BrCl2NO.C5H8Cl3NO/c2*6-1-5(2-7,3-8)4(9)10/h2*1-3H2,(H2,9,10).
What are the key properties of 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide?
2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide has a molecular weight of 453.42 g/mol, XLogP of 2.51, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-3-chloro-2-(chloromethyl)propanamide;3-chloro-2,2-bis(chloromethyl)propanamide is sourced from PubChem (CID 20564690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).