About dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate
dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate (PubChem CID 20565) has the molecular formula C11H13Cl3N2O3
and a molecular weight of 327.60 g/mol. Its IUPAC name is dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate.
Molecular Properties
| Compound Name | dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate |
| PubChem CID | 20565 |
| Molecular Formula | C11H13Cl3N2O3 |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate |
| SMILES | C[NH+](C)C(=O)Nc1ccccc1.O=C([O-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H12N2O.C2HCl3O2/c1-11(2)9(12)10-8-6-4-3-5-7-8;3-2(4,5)1(6)7/h3-7H,1-2H3,(H,10,12);(H,6,7) |
| InChIKey | XDWSZOWLJIWERG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate?
The IUPAC name of dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate (CID 20565) is dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate.
What is the SMILES notation for dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate?
The canonical SMILES for dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate is C[NH+](C)C(=O)Nc1ccccc1.O=C([O-])C(Cl)(Cl)Cl.
What is the InChIKey of dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate?
The InChIKey is XDWSZOWLJIWERG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O.C2HCl3O2/c1-11(2)9(12)10-8-6-4-3-5-7-8;3-2(4,5)1(6)7/h3-7H,1-2H3,(H,10,12);(H,6,7).
What are the key properties of dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate?
dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate has a molecular weight of 327.60 g/mol, XLogP of 0.47, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(phenylcarbamoyl)azanium;2,2,2-trichloroacetate is sourced from PubChem (CID 20565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).