About 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride
1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride (PubChem CID 20565245) has the molecular formula C8H17ClN2
and a molecular weight of 176.69 g/mol. Its IUPAC name is 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride.
Molecular Properties
| Compound Name | 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride |
| PubChem CID | 20565245 |
| Molecular Formula | C8H17ClN2 |
| Molecular Weight | 176.69 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride |
| SMILES | C=CCN(CC=C)C(C)N.Cl |
| InChI | InChI=1S/C8H16N2.ClH/c1-4-6-10(7-5-2)8(3)9;/h4-5,8H,1-2,6-7,9H2,3H3;1H |
| InChIKey | KBANAFSLUTXBSQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.69 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride?
The IUPAC name of 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride (CID 20565245) is 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride.
What is the SMILES notation for 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride?
The canonical SMILES for 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride is C=CCN(CC=C)C(C)N.Cl.
What is the InChIKey of 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride?
The InChIKey is KBANAFSLUTXBSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.ClH/c1-4-6-10(7-5-2)8(3)9;/h4-5,8H,1-2,6-7,9H2,3H3;1H.
What are the key properties of 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride?
1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride has a molecular weight of 176.69 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N',1-N'-bis(prop-2-enyl)ethane-1,1-diamine;hydrochloride is sourced from PubChem (CID 20565245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).