About 2-cyclohexyl-N-ethenyl-N-methylacetamide
2-cyclohexyl-N-ethenyl-N-methylacetamide (PubChem CID 20565273) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-cyclohexyl-N-ethenyl-N-methylacetamide.
Molecular Properties
| Compound Name | 2-cyclohexyl-N-ethenyl-N-methylacetamide |
| PubChem CID | 20565273 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-cyclohexyl-N-ethenyl-N-methylacetamide |
| SMILES | C=CN(C)C(=O)CC1CCCCC1 |
| InChI | InChI=1S/C11H19NO/c1-3-12(2)11(13)9-10-7-5-4-6-8-10/h3,10H,1,4-9H2,2H3 |
| InChIKey | SKKJVKLPXBTKTK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexyl-N-ethenyl-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-N-ethenyl-N-methylacetamide?
The IUPAC name of 2-cyclohexyl-N-ethenyl-N-methylacetamide (CID 20565273) is 2-cyclohexyl-N-ethenyl-N-methylacetamide.
What is the SMILES notation for 2-cyclohexyl-N-ethenyl-N-methylacetamide?
The canonical SMILES for 2-cyclohexyl-N-ethenyl-N-methylacetamide is C=CN(C)C(=O)CC1CCCCC1.
What is the InChIKey of 2-cyclohexyl-N-ethenyl-N-methylacetamide?
The InChIKey is SKKJVKLPXBTKTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-12(2)11(13)9-10-7-5-4-6-8-10/h3,10H,1,4-9H2,2H3.
What are the key properties of 2-cyclohexyl-N-ethenyl-N-methylacetamide?
2-cyclohexyl-N-ethenyl-N-methylacetamide has a molecular weight of 181.28 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-N-ethenyl-N-methylacetamide is sourced from PubChem (CID 20565273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).