About cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane
cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane (PubChem CID 20565338) has the molecular formula C24H18OSi
and a molecular weight of 350.49 g/mol. Its IUPAC name is cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane.
Molecular Properties
| Compound Name | cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane |
| PubChem CID | 20565338 |
| Molecular Formula | C24H18OSi |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane |
| SMILES | c1cccc(O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)c#1 |
| InChI | InChI=1S/C24H18OSi/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-5,7-13,15-20H |
| InChIKey | DRDWYOVFCWVNEG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane?
The IUPAC name of cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane (CID 20565338) is cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane.
What is the SMILES notation for cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane?
The canonical SMILES for cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane is c1cccc(O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)c#1.
What is the InChIKey of cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane?
The InChIKey is DRDWYOVFCWVNEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18OSi/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-5,7-13,15-20H.
What are the key properties of cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane?
cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane has a molecular weight of 350.49 g/mol, XLogP of 3.33, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,3-dien-5-yn-1-yloxy(triphenyl)silane is sourced from PubChem (CID 20565338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).