C14H11N3O3 — CID 20565458
4-(4-methoxyphenyl)-1H-pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 20565458) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1H-pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 4-(4-methoxyphenyl)-1H-pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 20565458 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-(4-methoxyphenyl)-1H-pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | COc1ccc(-n2c(=O)c(=O)[nH]c3cccnc32)cc1 |
| InChI | InChI=1S/C14H11N3O3/c1-20-10-6-4-9(5-7-10)17-12-11(3-2-8-15-12)16-13(18)14(17)19/h2-8H,1H3,(H,16,18) |
| InChIKey | SFDKDTDVKUVVAP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|