C18H21N5 — CID 20565820
6-(3,6-dihydro-2H-pyridin-1-yl)-1-propyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 20565820) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 6-(3,6-dihydro-2H-pyridin-1-yl)-1-propyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 6-(3,6-dihydro-2H-pyridin-1-yl)-1-propyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 20565820 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 6-(3,6-dihydro-2H-pyridin-1-yl)-1-propyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | CCCc1nnc2n1-c1ccccc1C(N1CC=CCC1)=NC2 |
| InChI | InChI=1S/C18H21N5/c1-2-8-16-20-21-17-13-19-18(22-11-6-3-7-12-22)14-9-4-5-10-15(14)23(16)17/h3-6,9-10H,2,7-8,11-13H2,1H3 |
| InChIKey | GVZGZTVRPBEZEO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|