C15H21Cl3O3 — CID 20565990
1,2,3-trichloro-4,5,6-tripropoxybenzene (PubChem CID 20565990) has the molecular formula C15H21Cl3O3 and a molecular weight of 355.69 g/mol. Its IUPAC name is 1,2,3-trichloro-4,5,6-tripropoxybenzene.
| Compound Name | 1,2,3-trichloro-4,5,6-tripropoxybenzene |
|---|---|
| PubChem CID | 20565990 |
| Molecular Formula | C15H21Cl3O3 |
| Molecular Weight | 355.69 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 1,2,3-trichloro-4,5,6-tripropoxybenzene |
| SMILES | CCCOc1c(Cl)c(Cl)c(Cl)c(OCCC)c1OCCC |
| InChI | InChI=1S/C15H21Cl3O3/c1-4-7-19-13-11(17)10(16)12(18)14(20-8-5-2)15(13)21-9-6-3/h4-9H2,1-3H3 |
| InChIKey | JOXIBSPQHLWIQC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.69 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|