About 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one
4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 20566141) has the molecular formula C10H15IO2
and a molecular weight of 294.13 g/mol. Its IUPAC name is 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one.
Molecular Properties
| Compound Name | 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one |
| PubChem CID | 20566141 |
| Molecular Formula | C10H15IO2 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | CC(C)(I)C1OC(=O)C2C1C2(C)C |
| InChI | InChI=1S/C10H15IO2/c1-9(2)5-6(9)8(12)13-7(5)10(3,4)11/h5-7H,1-4H3 |
| InChIKey | AAUPEDMYGAQBAP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one?
The IUPAC name of 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one (CID 20566141) is 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one.
What is the SMILES notation for 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one?
The canonical SMILES for 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one is CC(C)(I)C1OC(=O)C2C1C2(C)C.
What is the InChIKey of 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one?
The InChIKey is AAUPEDMYGAQBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15IO2/c1-9(2)5-6(9)8(12)13-7(5)10(3,4)11/h5-7H,1-4H3.
What are the key properties of 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one?
4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one has a molecular weight of 294.13 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-iodopropan-2-yl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one is sourced from PubChem (CID 20566141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).