About (4E)-4-ethylidene-2,5-dimethyloxolan-3-one
(4E)-4-ethylidene-2,5-dimethyloxolan-3-one (PubChem CID 20566149) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is (4E)-4-ethylidene-2,5-dimethyloxolan-3-one.
Molecular Properties
| Compound Name | (4E)-4-ethylidene-2,5-dimethyloxolan-3-one |
| PubChem CID | 20566149 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (4E)-4-ethylidene-2,5-dimethyloxolan-3-one |
| SMILES | C/C=C1/C(=O)C(C)OC1C |
| InChI | InChI=1S/C8H12O2/c1-4-7-5(2)10-6(3)8(7)9/h4-6H,1-3H3/b7-4+ |
| InChIKey | BATFTCKDWHEVJB-QPJJXVBHSA-N |
| XLogP | 1.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-ethylidene-2,5-dimethyloxolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-ethylidene-2,5-dimethyloxolan-3-one?
The IUPAC name of (4E)-4-ethylidene-2,5-dimethyloxolan-3-one (CID 20566149) is (4E)-4-ethylidene-2,5-dimethyloxolan-3-one.
What is the SMILES notation for (4E)-4-ethylidene-2,5-dimethyloxolan-3-one?
The canonical SMILES for (4E)-4-ethylidene-2,5-dimethyloxolan-3-one is C/C=C1/C(=O)C(C)OC1C.
What is the InChIKey of (4E)-4-ethylidene-2,5-dimethyloxolan-3-one?
The InChIKey is BATFTCKDWHEVJB-QPJJXVBHSA-N. The full InChI is InChI=1S/C8H12O2/c1-4-7-5(2)10-6(3)8(7)9/h4-6H,1-3H3/b7-4+.
What are the key properties of (4E)-4-ethylidene-2,5-dimethyloxolan-3-one?
(4E)-4-ethylidene-2,5-dimethyloxolan-3-one has a molecular weight of 140.18 g/mol, XLogP of 1.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-ethylidene-2,5-dimethyloxolan-3-one is sourced from PubChem (CID 20566149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).