C16H12Br2N2OS2 — CID 20566315
3,5-bis[(4-bromophenyl)sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 20566315) has the molecular formula C16H12Br2N2OS2 and a molecular weight of 472.23 g/mol. Its IUPAC name is 3,5-bis[(4-bromophenyl)sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 3,5-bis[(4-bromophenyl)sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 20566315 |
| Molecular Formula | C16H12Br2N2OS2 |
| Molecular Weight | 472.23 g/mol |
| Exact Mass | 469.88 |
| IUPAC Name | 3,5-bis[(4-bromophenyl)sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | Brc1ccc(SCc2noc(CSc3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/C16H12Br2N2OS2/c17-11-1-5-13(6-2-11)22-9-15-19-16(21-20-15)10-23-14-7-3-12(18)4-8-14/h1-8H,9-10H2 |
| InChIKey | QJCKJLCMOMPIBS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.23 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |