About 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone
1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone (PubChem CID 2056641) has the molecular formula C18H13ClF3NO2
and a molecular weight of 367.75 g/mol. Its IUPAC name is 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone |
| PubChem CID | 2056641 |
| Molecular Formula | C18H13ClF3NO2 |
| Molecular Weight | 367.75 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cn(CCOc2ccccc2Cl)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C18H13ClF3NO2/c19-14-6-2-4-8-16(14)25-10-9-23-11-13(17(24)18(20,21)22)12-5-1-3-7-15(12)23/h1-8,11H,9-10H2 |
| InChIKey | YAIYWVROEHTIGQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.75 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone?
The IUPAC name of 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone (CID 2056641) is 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone?
The canonical SMILES for 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone is O=C(c1cn(CCOc2ccccc2Cl)c2ccccc12)C(F)(F)F.
What is the InChIKey of 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone?
The InChIKey is YAIYWVROEHTIGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClF3NO2/c19-14-6-2-4-8-16(14)25-10-9-23-11-13(17(24)18(20,21)22)12-5-1-3-7-15(12)23/h1-8,11H,9-10H2.
What are the key properties of 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone?
1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone has a molecular weight of 367.75 g/mol, XLogP of 5.12, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]-2,2,2-trifluoroethanone is sourced from PubChem (CID 2056641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).