C30H54N2O4 — CID 20566790
[4-[(1,2,2,6,6-pentamethylpiperidine-4-carbonyl)oxymethyl]cyclohexyl]methyl 1,2,2,6,6-pentamethylpiperidine-4-carboxylate (PubChem CID 20566790) has the molecular formula C30H54N2O4 and a molecular weight of 506.77 g/mol. Its IUPAC name is [4-[(1,2,2,6,6-pentamethylpiperidine-4-carbonyl)oxymethyl]cyclohexyl]methyl 1,2,2,6,6-pentamethylpiperidine-4-carboxylate.
| Compound Name | [4-[(1,2,2,6,6-pentamethylpiperidine-4-carbonyl)oxymethyl]cyclohexyl]methyl 1,2,2,6,6-pentamethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 20566790 |
| Molecular Formula | C30H54N2O4 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.41 |
| IUPAC Name | [4-[(1,2,2,6,6-pentamethylpiperidine-4-carbonyl)oxymethyl]cyclohexyl]methyl 1,2,2,6,6-pentamethylpiperidine-4-carboxylate |
| SMILES | CN1C(C)(C)CC(C(=O)OCC2CCC(COC(=O)C3CC(C)(C)N(C)C(C)(C)C3)CC2)CC1(C)C |
| InChI | InChI=1S/C30H54N2O4/c1-27(2)15-23(16-28(3,4)31(27)9)25(33)35-19-21-11-13-22(14-12-21)20-36-26(34)24-17-29(5,6)32(10)30(7,8)18-24/h21-24H,11-20H2,1-10H3 |
| InChIKey | ZOHKFBVQELFOPN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |