C20H38O2 — CID 20566859
2-methyl-2-[(E)-4,8,12-trimethyltridec-3-enyl]-1,3-dioxolane (PubChem CID 20566859) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is 2-methyl-2-[(E)-4,8,12-trimethyltridec-3-enyl]-1,3-dioxolane.
| Compound Name | 2-methyl-2-[(E)-4,8,12-trimethyltridec-3-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 20566859 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 2-methyl-2-[(E)-4,8,12-trimethyltridec-3-enyl]-1,3-dioxolane |
| SMILES | C/C(=C\CCC1(C)OCCO1)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H38O2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)21-15-16-22-20/h13,17-18H,6-12,14-16H2,1-5H3/b19-13+ |
| InChIKey | FYLFGBUXVQLLQH-CPNJWEJPSA-N |
| XLogP | 6.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|